C18H23F3N2O3 — CID 70053161
tert-butyl (2R)-2-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 70053161) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70053161 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl (2R)-2-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H23F3N2O3/c1-17(2,3)26-16(25)23-9-5-8-14(23)15(24)22-11-12-6-4-7-13(10-12)18(19,20)21/h4,6-7,10,14H,5,8-9,11H2,1-3H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | ZMBZDOAPORHQOE-CQSZACIVSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |