C18H27ClN2 — CID 70053431
N-[(1R,2R)-2-phenylcyclopentyl]-2,3,4,5,6,7-hexahydroazocin-8-amine;hydrochloride (PubChem CID 70053431) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is N-[(1R,2R)-2-phenylcyclopentyl]-2,3,4,5,6,7-hexahydroazocin-8-amine;hydrochloride.
| Compound Name | N-[(1R,2R)-2-phenylcyclopentyl]-2,3,4,5,6,7-hexahydroazocin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 70053431 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[(1R,2R)-2-phenylcyclopentyl]-2,3,4,5,6,7-hexahydroazocin-8-amine;hydrochloride |
| SMILES | Cl.c1ccc([C@H]2CCC[C@H]2N/C2=N/CCCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2.ClH/c1-2-7-14-19-18(13-6-1)20-17-12-8-11-16(17)15-9-4-3-5-10-15;/h3-5,9-10,16-17H,1-2,6-8,11-14H2,(H,19,20);1H/t16-,17-;/m1./s1 |
| InChIKey | YIEDTWKWOCGNJY-GBNZRNLASA-N |
| XLogP | 4.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |