C19H27ClN6O3 — CID 70053538
4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride (PubChem CID 70053538) has the molecular formula C19H27ClN6O3 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride.
| Compound Name | 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70053538 |
| Molecular Formula | C19H27ClN6O3 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(/C(N)=N/C)cc3)nc2n(CCC)c1=O.Cl.O |
| InChI | InChI=1S/C19H24N6O2.ClH.H2O/c1-4-10-24-17-14(18(26)25(11-5-2)19(24)27)22-16(23-17)13-8-6-12(7-9-13)15(20)21-3;;/h6-9H,4-5,10-11H2,1-3H3,(H2,20,21)(H,22,23);1H;1H2 |
| InChIKey | VJPXXSVYSUHIAK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|