C22H22N2O6S — CID 70053888
methyl 3-(hydroxymethyl)-2-(4-methoxyphenyl)sulfonyl-4-(pyridin-3-ylmethylamino)benzoate (PubChem CID 70053888) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is methyl 3-(hydroxymethyl)-2-(4-methoxyphenyl)sulfonyl-4-(pyridin-3-ylmethylamino)benzoate.
| Compound Name | methyl 3-(hydroxymethyl)-2-(4-methoxyphenyl)sulfonyl-4-(pyridin-3-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 70053888 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl 3-(hydroxymethyl)-2-(4-methoxyphenyl)sulfonyl-4-(pyridin-3-ylmethylamino)benzoate |
| SMILES | COC(=O)c1ccc(NCc2cccnc2)c(CO)c1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-29-16-5-7-17(8-6-16)31(27,28)21-18(22(26)30-2)9-10-20(19(21)14-25)24-13-15-4-3-11-23-12-15/h3-12,24-25H,13-14H2,1-2H3 |
| InChIKey | NIJONSPVGYIHGZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |