About 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid
2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid (PubChem CID 70053944) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid |
| PubChem CID | 70053944 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid |
| SMILES | CCc1cc(OC)ccc1S(=O)(=O)Nc1c(C)cc(C)cc1C(=O)O |
| InChI | InChI=1S/C18H21NO5S/c1-5-13-10-14(24-4)6-7-16(13)25(22,23)19-17-12(3)8-11(2)9-15(17)18(20)21/h6-10,19H,5H2,1-4H3,(H,20,21) |
| InChIKey | MXQNKPZSACMUIS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The IUPAC name of 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid (CID 70053944) is 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid.
What is the SMILES notation for 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The canonical SMILES for 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid is CCc1cc(OC)ccc1S(=O)(=O)Nc1c(C)cc(C)cc1C(=O)O.
What is the InChIKey of 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
The InChIKey is MXQNKPZSACMUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-5-13-10-14(24-4)6-7-16(13)25(22,23)19-17-12(3)8-11(2)9-15(17)18(20)21/h6-10,19H,5H2,1-4H3,(H,20,21).
What are the key properties of 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid?
2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid has a molecular weight of 363.44 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-4-methoxyphenyl)sulfonylamino]-3,5-dimethylbenzoic acid is sourced from PubChem (CID 70053944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).