C10H13NO — CID 70054036
1-methyl-3,4,4a,5-tetrahydroquinolin-2-one (PubChem CID 70054036) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-methyl-3,4,4a,5-tetrahydroquinolin-2-one.
| Compound Name | 1-methyl-3,4,4a,5-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 70054036 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-methyl-3,4,4a,5-tetrahydroquinolin-2-one |
| SMILES | CN1C(=O)CCC2CC=CC=C21 |
| InChI | InChI=1S/C10H13NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | OQVKRHWXEUXECU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |