C29H28N4O5 — CID 70055204
3-[7-[4-[(2-amino-3-pyridinyl)oxy]but-1-ynyl]-1-benzyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 70055204) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is 3-[7-[4-[(2-amino-3-pyridinyl)oxy]but-1-ynyl]-1-benzyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]but-1-ynyl]-1-benzyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 70055204 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 3-[7-[4-[(2-amino-3-pyridinyl)oxy]but-1-ynyl]-1-benzyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1CC(=O)N(Cc2ccccc2)c2ccc(C#CCCOc3cccnc3N)cc2C1=O |
| InChI | InChI=1S/C29H28N4O5/c1-20(16-27(35)36)32-19-26(34)33(18-22-9-3-2-4-10-22)24-13-12-21(17-23(24)29(32)37)8-5-6-15-38-25-11-7-14-31-28(25)30/h2-4,7,9-14,17,20H,6,15-16,18-19H2,1H3,(H2,30,31)(H,35,36) |
| InChIKey | RGNOYGVROHSXDE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|