C17H14N4S — CID 700555
5-(2-phenylethyl)-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 700555) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-(2-phenylethyl)-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 5-(2-phenylethyl)-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 700555 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 5-(2-phenylethyl)-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | S=c1nc2c(n[nH]1)c1ccccc1n2CCc1ccccc1 |
| InChI | InChI=1S/C17H14N4S/c22-17-18-16-15(19-20-17)13-8-4-5-9-14(13)21(16)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,18,20,22) |
| InChIKey | JZMKJONDRDUVGT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|