C24H27NO5 — CID 70055909
dimethyl 7,10a-dimethyl-9-(4-methylphenyl)-4,5,9,10-tetrahydrofuro[2,3-a]quinolizine-8,10-dicarboxylate (PubChem CID 70055909) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is dimethyl 7,10a-dimethyl-9-(4-methylphenyl)-4,5,9,10-tetrahydrofuro[2,3-a]quinolizine-8,10-dicarboxylate.
| Compound Name | dimethyl 7,10a-dimethyl-9-(4-methylphenyl)-4,5,9,10-tetrahydrofuro[2,3-a]quinolizine-8,10-dicarboxylate |
|---|---|
| PubChem CID | 70055909 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | dimethyl 7,10a-dimethyl-9-(4-methylphenyl)-4,5,9,10-tetrahydrofuro[2,3-a]quinolizine-8,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N2CCc3ccoc3C2(C)C(C(=O)OC)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-14-6-8-16(9-7-14)19-18(22(26)28-4)15(2)25-12-10-17-11-13-30-21(17)24(25,3)20(19)23(27)29-5/h6-9,11,13,19-20H,10,12H2,1-5H3 |
| InChIKey | BQSFOJVTXCWJCU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |