C31H27N3O4 — CID 70057446
ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate (PubChem CID 70057446) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate.
| Compound Name | ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
|---|---|
| PubChem CID | 70057446 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
| SMILES | CCOC(=O)CC(C)N1C(=O)c2cc(C#Cc3cccc(C#N)c3)ccc2N(C)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C31H27N3O4/c1-4-38-28(35)17-21(2)34-29(25-11-6-5-7-12-25)31(37)33(3)27-16-15-23(19-26(27)30(34)36)14-13-22-9-8-10-24(18-22)20-32/h5-12,15-16,18-19,21,29H,4,17H2,1-3H3 |
| InChIKey | WGYAWFYZGKBEHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|