C9H12O5 — CID 70057648
6-hydroxy-2,4,6-trimethoxycyclohexa-2,4-dien-1-one (PubChem CID 70057648) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 6-hydroxy-2,4,6-trimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 6-hydroxy-2,4,6-trimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 70057648 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 6-hydroxy-2,4,6-trimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(O)(OC)C(=O)C(OC)=C1 |
| InChI | InChI=1S/C9H12O5/c1-12-6-4-7(13-2)8(10)9(11,5-6)14-3/h4-5,11H,1-3H3 |
| InChIKey | LHQUMRRPVFTXJU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|