C14H22N2 — CID 70058066
2-methyl-1-N-propyl-1,2,3,4-tetrahydronaphthalene-1,5-diamine (PubChem CID 70058066) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-1-N-propyl-1,2,3,4-tetrahydronaphthalene-1,5-diamine.
| Compound Name | 2-methyl-1-N-propyl-1,2,3,4-tetrahydronaphthalene-1,5-diamine |
|---|---|
| PubChem CID | 70058066 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-methyl-1-N-propyl-1,2,3,4-tetrahydronaphthalene-1,5-diamine |
| SMILES | CCCNC1c2cccc(N)c2CCC1C |
| InChI | InChI=1S/C14H22N2/c1-3-9-16-14-10(2)7-8-11-12(14)5-4-6-13(11)15/h4-6,10,14,16H,3,7-9,15H2,1-2H3 |
| InChIKey | YBEKRAMNNNSOBM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|