C20H28F3N5O4 — CID 70058146
2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 70058146) has the molecular formula C20H28F3N5O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70058146 |
| Molecular Formula | C20H28F3N5O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C18H27N5O2.C2HF3O2/c19-18(20)14-1-3-15(4-2-14)22-9-11-23(12-10-22)16-5-7-21(8-6-16)13-17(24)25;3-2(4,5)1(6)7/h1-4,16H,5-13H2,(H3,19,20)(H,24,25);(H,6,7) |
| InChIKey | TXZQLCFLDFRRTI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|