About N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide
N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide (PubChem CID 70058325) has the molecular formula C22H31N3O2
and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide |
| PubChem CID | 70058325 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide |
| SMILES | CCCCCN(C(=O)N1CCCC1=O)N1CC=CC(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H31N3O2/c1-3-4-5-16-25(22(27)24-15-7-9-21(24)26)23-14-6-8-20(17-23)19-12-10-18(2)11-13-19/h6,8,10-13,20H,3-5,7,9,14-17H2,1-2H3 |
| InChIKey | RAVFQJFXLIDGAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide?
The IUPAC name of N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide (CID 70058325) is N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide.
What is the SMILES notation for N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide?
The canonical SMILES for N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide is CCCCCN(C(=O)N1CCCC1=O)N1CC=CC(c2ccc(C)cc2)C1.
What is the InChIKey of N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide?
The InChIKey is RAVFQJFXLIDGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O2/c1-3-4-5-16-25(22(27)24-15-7-9-21(24)26)23-14-6-8-20(17-23)19-12-10-18(2)11-13-19/h6,8,10-13,20H,3-5,7,9,14-17H2,1-2H3.
What are the key properties of N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide?
N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide has a molecular weight of 369.51 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxo-N-pentylpyrrolidine-1-carboxamide is sourced from PubChem (CID 70058325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).