About 6-ethyl-1H-pyridin-2-one;methane
6-ethyl-1H-pyridin-2-one;methane (PubChem CID 70058402) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 6-ethyl-1H-pyridin-2-one;methane.
Molecular Properties
| Compound Name | 6-ethyl-1H-pyridin-2-one;methane |
| PubChem CID | 70058402 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 6-ethyl-1H-pyridin-2-one;methane |
| SMILES | C.CCc1cccc(=O)[nH]1 |
| InChI | InChI=1S/C7H9NO.CH4/c1-2-6-4-3-5-7(9)8-6;/h3-5H,2H2,1H3,(H,8,9);1H4 |
| InChIKey | WNDYTIJKDKLPRO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-1H-pyridin-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1H-pyridin-2-one;methane?
The IUPAC name of 6-ethyl-1H-pyridin-2-one;methane (CID 70058402) is 6-ethyl-1H-pyridin-2-one;methane.
What is the SMILES notation for 6-ethyl-1H-pyridin-2-one;methane?
The canonical SMILES for 6-ethyl-1H-pyridin-2-one;methane is C.CCc1cccc(=O)[nH]1.
What is the InChIKey of 6-ethyl-1H-pyridin-2-one;methane?
The InChIKey is WNDYTIJKDKLPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.CH4/c1-2-6-4-3-5-7(9)8-6;/h3-5H,2H2,1H3,(H,8,9);1H4.
What are the key properties of 6-ethyl-1H-pyridin-2-one;methane?
6-ethyl-1H-pyridin-2-one;methane has a molecular weight of 139.20 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1H-pyridin-2-one;methane is sourced from PubChem (CID 70058402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).