C32H39Cl3N4O5 — CID 70058807
[7-chloro-1-[2-methoxy-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] (2S)-2,6-diaminohexanoate;dihydrochloride (PubChem CID 70058807) has the molecular formula C32H39Cl3N4O5 and a molecular weight of 666.05 g/mol. Its IUPAC name is [7-chloro-1-[2-methoxy-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] (2S)-2,6-diaminohexanoate;dihydrochloride.
| Compound Name | [7-chloro-1-[2-methoxy-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] (2S)-2,6-diaminohexanoate;dihydrochloride |
|---|---|
| PubChem CID | 70058807 |
| Molecular Formula | C32H39Cl3N4O5 |
| Molecular Weight | 666.05 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | [7-chloro-1-[2-methoxy-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] (2S)-2,6-diaminohexanoate;dihydrochloride |
| SMILES | COc1cc(NC(=O)c2ccccc2C)ccc1C(=O)N1CCCC(OC(=O)[C@@H](N)CCCCN)c2cc(Cl)ccc21.Cl.Cl |
| InChI | InChI=1S/C32H37ClN4O5.2ClH/c1-20-8-3-4-9-23(20)30(38)36-22-13-14-24(29(19-22)41-2)31(39)37-17-7-11-28(25-18-21(33)12-15-27(25)37)42-32(40)26(35)10-5-6-16-34;;/h3-4,8-9,12-15,18-19,26,28H,5-7,10-11,16-17,34-35H2,1-2H3,(H,36,38);2*1H/t26-,28?;;/m0../s1 |
| InChIKey | KMIZCWFNBZSHMQ-IOYJZATOSA-N |
| XLogP | 6.23 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.05 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|