About (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol
(3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol (PubChem CID 7005977) has the molecular formula C5H10O4S
and a molecular weight of 166.20 g/mol. Its IUPAC name is (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol |
| PubChem CID | 7005977 |
| Molecular Formula | C5H10O4S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol |
| SMILES | CO[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C5H10O4S/c1-9-5-3-10(7,8)2-4(5)6/h4-6H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | IEIXUOFOSLJYOT-RFZPGFLSSA-N |
| XLogP | -1.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol?
The IUPAC name of (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol (CID 7005977) is (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol is CO[C@@H]1CS(=O)(=O)C[C@H]1O.
What is the InChIKey of (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol?
The InChIKey is IEIXUOFOSLJYOT-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H10O4S/c1-9-5-3-10(7,8)2-4(5)6/h4-6H,2-3H2,1H3/t4-,5-/m1/s1.
What are the key properties of (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol?
(3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol has a molecular weight of 166.20 g/mol, XLogP of -1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-methoxy-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 7005977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).