C50H60N4O5 — CID 70059848
benzyl N-[2-(2-amino-4-carbamoylphenyl)ethyl]-N-[(6S)-6-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(propylamino)hexyl]carbamate (PubChem CID 70059848) has the molecular formula C50H60N4O5 and a molecular weight of 797.05 g/mol. Its IUPAC name is benzyl N-[2-(2-amino-4-carbamoylphenyl)ethyl]-N-[(6S)-6-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(propylamino)hexyl]carbamate.
| Compound Name | benzyl N-[2-(2-amino-4-carbamoylphenyl)ethyl]-N-[(6S)-6-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(propylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 70059848 |
| Molecular Formula | C50H60N4O5 |
| Molecular Weight | 797.05 g/mol |
| Exact Mass | 796.46 |
| IUPAC Name | benzyl N-[2-(2-amino-4-carbamoylphenyl)ethyl]-N-[(6S)-6-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(propylamino)hexyl]carbamate |
| SMILES | CCCN[C@@H](CCCCCN(CCc1ccc(C(N)=O)cc1N)C(=O)OCc1ccccc1)C1CCc2c(ccc(OCc3ccccc3)c2OCc2ccccc2)C1 |
| InChI | InChI=1S/C50H60N4O5/c1-2-29-53-46(21-13-6-14-30-54(50(56)59-36-39-19-11-5-12-20-39)31-28-40-22-23-43(49(52)55)33-45(40)51)42-24-26-44-41(32-42)25-27-47(57-34-37-15-7-3-8-16-37)48(44)58-35-38-17-9-4-10-18-38/h3-5,7-12,15-20,22-23,25,27,33,42,46,53H,2,6,13-14,21,24,26,28-32,34-36,51H2,1H3,(H2,52,55)/t42?,46-/m0/s1 |
| InChIKey | CYTQPZCXMJZELB-FLDCQSRISA-N |
| XLogP | 9.44 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.05 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|