C22H32F3N5O4 — CID 70059880
ethyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 70059880) has the molecular formula C22H32F3N5O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70059880 |
| Molecular Formula | C22H32F3N5O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | ethyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H31N5O2.C2HF3O2/c1-2-27-19(26)15-23-9-7-18(8-10-23)25-13-11-24(12-14-25)17-5-3-16(4-6-17)20(21)22;3-2(4,5)1(6)7/h3-6,18H,2,7-15H2,1H3,(H3,21,22);(H,6,7) |
| InChIKey | GKOFINRLMGGEPZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|