C25H39N5O4 — CID 70059915
tert-butyl 2-[4-[4-[4-[(ethoxycarbonylhydrazinylidene)methyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 70059915) has the molecular formula C25H39N5O4 and a molecular weight of 473.62 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[4-[(ethoxycarbonylhydrazinylidene)methyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[4-[4-[(ethoxycarbonylhydrazinylidene)methyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 70059915 |
| Molecular Formula | C25H39N5O4 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | tert-butyl 2-[4-[4-[4-[(ethoxycarbonylhydrazinylidene)methyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)NN=Cc1ccc(N2CCN(C3CCN(CC(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H39N5O4/c1-5-33-24(32)27-26-18-20-6-8-21(9-7-20)29-14-16-30(17-15-29)22-10-12-28(13-11-22)19-23(31)34-25(2,3)4/h6-9,18,22H,5,10-17,19H2,1-4H3,(H,27,32) |
| InChIKey | AFIJYOJQCBMKRJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|