C23H35F3N6O4 — CID 70060091
tert-butyl 2-[4-[4-(6-carbamimidoyl-3-pyridinyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 70060091) has the molecular formula C23H35F3N6O4 and a molecular weight of 516.57 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(6-carbamimidoyl-3-pyridinyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl 2-[4-[4-(6-carbamimidoyl-3-pyridinyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70060091 |
| Molecular Formula | C23H35F3N6O4 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | tert-butyl 2-[4-[4-(6-carbamimidoyl-3-pyridinyl)piperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OC(C)(C)C)CC3)CC2)cn1 |
| InChI | InChI=1S/C21H34N6O2.C2HF3O2/c1-21(2,3)29-19(28)15-25-8-6-16(7-9-25)26-10-12-27(13-11-26)17-4-5-18(20(22)23)24-14-17;3-2(4,5)1(6)7/h4-5,14,16H,6-13,15H2,1-3H3,(H3,22,23);(H,6,7) |
| InChIKey | MLZQLHJMTXDIFT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|