About 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile
4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile (PubChem CID 70060159) has the molecular formula C17H24N4
and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile |
| PubChem CID | 70060159 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile |
| SMILES | C[C@@H]1CNCC[C@@H]1N1CCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C17H24N4/c1-14-13-19-7-6-17(14)21-10-8-20(9-11-21)16-4-2-15(12-18)3-5-16/h2-5,14,17,19H,6-11,13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | XAJSLPBBUVICMV-PBHICJAKSA-N |
| XLogP | 1.68 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile?
The IUPAC name of 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile (CID 70060159) is 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile.
What is the SMILES notation for 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile?
The canonical SMILES for 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile is C[C@@H]1CNCC[C@@H]1N1CCN(c2ccc(C#N)cc2)CC1.
What is the InChIKey of 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile?
The InChIKey is XAJSLPBBUVICMV-PBHICJAKSA-N. The full InChI is InChI=1S/C17H24N4/c1-14-13-19-7-6-17(14)21-10-8-20(9-11-21)16-4-2-15(12-18)3-5-16/h2-5,14,17,19H,6-11,13H2,1H3/t14-,17+/m1/s1.
What are the key properties of 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile?
4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile has a molecular weight of 284.41 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(3R,4S)-3-methylpiperidin-4-yl]piperazin-1-yl]benzonitrile is sourced from PubChem (CID 70060159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).