C25H38F3N5O4 — CID 70060625
tert-butyl 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 70060625) has the molecular formula C25H38F3N5O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70060625 |
| Molecular Formula | C25H38F3N5O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | tert-butyl 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OC(C)(C)C)CC3)C(C)C2)cc1 |
| InChI | InChI=1S/C23H37N5O2.C2HF3O2/c1-17-15-27(19-7-5-18(6-8-19)22(24)25)13-14-28(17)20-9-11-26(12-10-20)16-21(29)30-23(2,3)4;3-2(4,5)1(6)7/h5-8,17,20H,9-16H2,1-4H3,(H3,24,25);(H,6,7) |
| InChIKey | OCOOJIUWNXCYHD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|