C12H17N — CID 70061290
1-methyl-3,3a,4,4a,5,6-hexahydro-2H-indeno[1,2-b]pyrrole (PubChem CID 70061290) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-methyl-3,3a,4,4a,5,6-hexahydro-2H-indeno[1,2-b]pyrrole.
| Compound Name | 1-methyl-3,3a,4,4a,5,6-hexahydro-2H-indeno[1,2-b]pyrrole |
|---|---|
| PubChem CID | 70061290 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-methyl-3,3a,4,4a,5,6-hexahydro-2H-indeno[1,2-b]pyrrole |
| SMILES | CN1CCC2CC3CCC=CC3=C21 |
| InChI | InChI=1S/C12H17N/c1-13-7-6-10-8-9-4-2-3-5-11(9)12(10)13/h3,5,9-10H,2,4,6-8H2,1H3 |
| InChIKey | YHUMLCRHQHNRJG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |