C22H33N5O2 — CID 70062541
3-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]-7-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 70062541) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]-7-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]-7-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 70062541 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 3-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]-7-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | Nc1nccc(N2CCC(N3C(=O)OC4C(C5CCCCC5)CCCC43)CC2)n1 |
| InChI | InChI=1S/C22H33N5O2/c23-21-24-12-9-19(25-21)26-13-10-16(11-14-26)27-18-8-4-7-17(20(18)29-22(27)28)15-5-2-1-3-6-15/h9,12,15-18,20H,1-8,10-11,13-14H2,(H2,23,24,25) |
| InChIKey | PZJTZVDAJLUNNC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |