C24H24ClN3O5S — CID 70062554
dimethyl 4-(3-chlorophenyl)-2-methyl-6-[(pyridine-3-carbonylamino)methylsulfanylmethyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70062554) has the molecular formula C24H24ClN3O5S and a molecular weight of 501.99 g/mol. Its IUPAC name is dimethyl 4-(3-chlorophenyl)-2-methyl-6-[(pyridine-3-carbonylamino)methylsulfanylmethyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(3-chlorophenyl)-2-methyl-6-[(pyridine-3-carbonylamino)methylsulfanylmethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70062554 |
| Molecular Formula | C24H24ClN3O5S |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | dimethyl 4-(3-chlorophenyl)-2-methyl-6-[(pyridine-3-carbonylamino)methylsulfanylmethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(CSCNC(=O)c2cccnc2)=C(C(=O)OC)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClN3O5S/c1-14-19(23(30)32-2)20(15-6-4-8-17(25)10-15)21(24(31)33-3)18(28-14)12-34-13-27-22(29)16-7-5-9-26-11-16/h4-11,20,28H,12-13H2,1-3H3,(H,27,29) |
| InChIKey | ATOMNSGRUZWFQV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|