C38H53NO4Si — CID 70062595
tert-butyl N-[(2S,3S,5R)-5-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,8-diphenyloctan-2-yl]carbamate (PubChem CID 70062595) has the molecular formula C38H53NO4Si and a molecular weight of 615.93 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-5-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,8-diphenyloctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-5-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,8-diphenyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 70062595 |
| Molecular Formula | C38H53NO4Si |
| Molecular Weight | 615.93 g/mol |
| Exact Mass | 615.37 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-5-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,8-diphenyloctan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](C[C@@H](Cc1ccccc1)C(=O)CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H53NO4Si/c1-37(2,3)42-36(41)39-33(27-31-22-16-11-17-23-31)35(43-44(7,8)38(4,5)6)28-32(26-30-20-14-10-15-21-30)34(40)25-24-29-18-12-9-13-19-29/h9-23,32-33,35H,24-28H2,1-8H3,(H,39,41)/t32-,33+,35+/m1/s1 |
| InChIKey | ALWBQQMVZHAMJA-QDHDVKAFSA-N |
| XLogP | 8.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.93 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|