About methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride
methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride (PubChem CID 70062887) has the molecular formula C16H25ClN2O4S
and a molecular weight of 376.91 g/mol. Its IUPAC name is methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride |
| PubChem CID | 70062887 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cscc1NC(=O)C(O)[C@H](N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-22-16(21)11-8-23-9-13(11)18-15(20)14(19)12(17)7-10-5-3-2-4-6-10;/h8-10,12,14,19H,2-7,17H2,1H3,(H,18,20);1H/t12-,14?;/m1./s1 |
| InChIKey | ORESWLWJNGSSQI-UYUUDJTFSA-N |
| XLogP | 2.55 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride?
The IUPAC name of methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride (CID 70062887) is methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride is COC(=O)c1cscc1NC(=O)C(O)[C@H](N)CC1CCCCC1.Cl.
What is the InChIKey of methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride?
The InChIKey is ORESWLWJNGSSQI-UYUUDJTFSA-N. The full InChI is InChI=1S/C16H24N2O4S.ClH/c1-22-16(21)11-8-23-9-13(11)18-15(20)14(19)12(17)7-10-5-3-2-4-6-10;/h8-10,12,14,19H,2-7,17H2,1H3,(H,18,20);1H/t12-,14?;/m1./s1.
What are the key properties of methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride?
methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride has a molecular weight of 376.91 g/mol, XLogP of 2.55, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride is sourced from PubChem (CID 70062887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).