About [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid
[(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid (PubChem CID 70063474) has the molecular formula C12H10F3N2O5P
and a molecular weight of 350.19 g/mol. Its IUPAC name is [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid |
| PubChem CID | 70063474 |
| Molecular Formula | C12H10F3N2O5P |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)ccc2n(C/C=C\P(=O)(O)O)c1=O |
| InChI | InChI=1S/C12H10F3N2O5P/c13-12(14,15)7-2-3-9-8(6-7)16-10(18)11(19)17(9)4-1-5-23(20,21)22/h1-3,5-6H,4H2,(H,16,18)(H2,20,21,22)/b5-1- |
| InChIKey | TZTLSHMLBDPGGW-KTAJNNJTSA-N |
| XLogP | 1.40 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid?
The IUPAC name of [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid (CID 70063474) is [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid.
What is the SMILES notation for [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid?
The canonical SMILES for [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid is O=c1[nH]c2cc(C(F)(F)F)ccc2n(C/C=C\P(=O)(O)O)c1=O.
What is the InChIKey of [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid?
The InChIKey is TZTLSHMLBDPGGW-KTAJNNJTSA-N. The full InChI is InChI=1S/C12H10F3N2O5P/c13-12(14,15)7-2-3-9-8(6-7)16-10(18)11(19)17(9)4-1-5-23(20,21)22/h1-3,5-6H,4H2,(H,16,18)(H2,20,21,22)/b5-1-.
What are the key properties of [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid?
[(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid has a molecular weight of 350.19 g/mol, XLogP of 1.40, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-[2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]prop-1-enyl]phosphonic acid is sourced from PubChem (CID 70063474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).