C12H12O2 — CID 70064291
4,5,8,9a-tetrahydroindeno[2,1-b]pyran-3-one (PubChem CID 70064291) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4,5,8,9a-tetrahydroindeno[2,1-b]pyran-3-one.
| Compound Name | 4,5,8,9a-tetrahydroindeno[2,1-b]pyran-3-one |
|---|---|
| PubChem CID | 70064291 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4,5,8,9a-tetrahydroindeno[2,1-b]pyran-3-one |
| SMILES | O=C1COC2C=C3CC=CCC3=C2C1 |
| InChI | InChI=1S/C12H12O2/c13-9-6-11-10-4-2-1-3-8(10)5-12(11)14-7-9/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | WFOUELQEGRVRMU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|