C28H39N3O3 — CID 70064302
2-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1,1-di(propan-2-yl)guanidine (PubChem CID 70064302) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1,1-di(propan-2-yl)guanidine.
| Compound Name | 2-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1,1-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 70064302 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 2-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1,1-di(propan-2-yl)guanidine |
| SMILES | CC(C)N(/C(N)=N/c1cccc(C(c2c(O)c3c(oc2=O)CCCCCC3)C2CC2)c1)C(C)C |
| InChI | InChI=1S/C28H39N3O3/c1-17(2)31(18(3)4)28(29)30-21-11-9-10-20(16-21)24(19-14-15-19)25-26(32)22-12-7-5-6-8-13-23(22)34-27(25)33/h9-11,16-19,24,32H,5-8,12-15H2,1-4H3,(H2,29,30) |
| InChIKey | OPMBZVYSYUYOKL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|