About (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol
(1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol (PubChem CID 7006444) has the molecular formula C16H11F3O
and a molecular weight of 276.26 g/mol. Its IUPAC name is (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol |
| PubChem CID | 7006444 |
| Molecular Formula | C16H11F3O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1c2ccccc2cc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H/t15-/m1/s1 |
| InChIKey | ICZHJFWIOPYQCA-OAHLLOKOSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol?
The IUPAC name of (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol (CID 7006444) is (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol.
What is the SMILES notation for (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol?
The canonical SMILES for (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol is O[C@H](c1c2ccccc2cc2ccccc12)C(F)(F)F.
What is the InChIKey of (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol?
The InChIKey is ICZHJFWIOPYQCA-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H/t15-/m1/s1.
What are the key properties of (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol?
(1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol has a molecular weight of 276.26 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-anthracen-9-yl-2,2,2-trifluoroethanol is sourced from PubChem (CID 7006444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).