C30H29N3O4 — CID 70064531
3-[7-(5-aminopent-1-ynyl)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 70064531) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-[7-(5-aminopent-1-ynyl)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(5-aminopent-1-ynyl)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 70064531 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-[7-(5-aminopent-1-ynyl)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NCCCC#Cc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29N3O4/c31-18-9-3-4-10-22-15-16-26-25(20-22)30(37)32(19-17-28(35)36)21-27(34)33(26)29(23-11-5-1-6-12-23)24-13-7-2-8-14-24/h1-2,5-8,11-16,20,29H,3,9,17-19,21,31H2,(H,35,36) |
| InChIKey | NAVPBIFASBFPAB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|