C14H10N2OS — CID 70064784
3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-2(6),4,9,11,13,15-hexaen-8-one (PubChem CID 70064784) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-2(6),4,9,11,13,15-hexaen-8-one.
| Compound Name | 3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-2(6),4,9,11,13,15-hexaen-8-one |
|---|---|
| PubChem CID | 70064784 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-thia-7,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-2(6),4,9,11,13,15-hexaen-8-one |
| SMILES | O=C1C=C2c3ccccc3NC2c2sccc2N1 |
| InChI | InChI=1S/C14H10N2OS/c17-12-7-9-8-3-1-2-4-10(8)16-13(9)14-11(15-12)5-6-18-14/h1-7,13,16H,(H,15,17) |
| InChIKey | VXYGWJPKHWQMDO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |