C28H27NO4 — CID 70065091
(3R)-3-[[3-(9H-fluoren-9-ylmethoxy)-3-oxo-1-phenylprop-1-en-2-yl]amino]pentanoic acid (PubChem CID 70065091) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (3R)-3-[[3-(9H-fluoren-9-ylmethoxy)-3-oxo-1-phenylprop-1-en-2-yl]amino]pentanoic acid.
| Compound Name | (3R)-3-[[3-(9H-fluoren-9-ylmethoxy)-3-oxo-1-phenylprop-1-en-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70065091 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (3R)-3-[[3-(9H-fluoren-9-ylmethoxy)-3-oxo-1-phenylprop-1-en-2-yl]amino]pentanoic acid |
| SMILES | CC[C@H](CC(=O)O)NC(=Cc1ccccc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H27NO4/c1-2-20(17-27(30)31)29-26(16-19-10-4-3-5-11-19)28(32)33-18-25-23-14-8-6-12-21(23)22-13-7-9-15-24(22)25/h3-16,20,25,29H,2,17-18H2,1H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | RQALBMOXNSKUGF-HXUWFJFHSA-N |
| XLogP | 5.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|