C9H14F3N3O4 — CID 70065222
piperidine-1,3-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 70065222) has the molecular formula C9H14F3N3O4 and a molecular weight of 285.22 g/mol. Its IUPAC name is piperidine-1,3-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | piperidine-1,3-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70065222 |
| Molecular Formula | C9H14F3N3O4 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | piperidine-1,3-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)C1CCCN(C(N)=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H13N3O2.C2HF3O2/c8-6(11)5-2-1-3-10(4-5)7(9)12;3-2(4,5)1(6)7/h5H,1-4H2,(H2,8,11)(H2,9,12);(H,6,7) |
| InChIKey | COCHSHVGUCQCIN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |