C39H48N2O7 — CID 70065564
(Z)-2-[4-(4,4-diphenylbutyl)-1-[2-(1-ethyl-6,7-dimethoxy-3,4-dihydroisochromen-1-yl)ethyl]piperazin-2-yl]but-2-enedioic acid (PubChem CID 70065564) has the molecular formula C39H48N2O7 and a molecular weight of 656.82 g/mol. Its IUPAC name is (Z)-2-[4-(4,4-diphenylbutyl)-1-[2-(1-ethyl-6,7-dimethoxy-3,4-dihydroisochromen-1-yl)ethyl]piperazin-2-yl]but-2-enedioic acid.
| Compound Name | (Z)-2-[4-(4,4-diphenylbutyl)-1-[2-(1-ethyl-6,7-dimethoxy-3,4-dihydroisochromen-1-yl)ethyl]piperazin-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70065564 |
| Molecular Formula | C39H48N2O7 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | (Z)-2-[4-(4,4-diphenylbutyl)-1-[2-(1-ethyl-6,7-dimethoxy-3,4-dihydroisochromen-1-yl)ethyl]piperazin-2-yl]but-2-enedioic acid |
| SMILES | CCC1(CCN2CCN(CCCC(c3ccccc3)c3ccccc3)CC2/C(=C/C(=O)O)C(=O)O)OCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C39H48N2O7/c1-4-39(33-26-36(47-3)35(46-2)24-30(33)17-23-48-39)18-20-41-22-21-40(27-34(41)32(38(44)45)25-37(42)43)19-11-16-31(28-12-7-5-8-13-28)29-14-9-6-10-15-29/h5-10,12-15,24-26,31,34H,4,11,16-23,27H2,1-3H3,(H,42,43)(H,44,45)/b32-25- |
| InChIKey | GYKGNMUGJXDLQO-MKCFTUBBSA-N |
| XLogP | 5.97 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|