C20H25IN2O — CID 70065777
1-iodo-N-(3-methylbut-2-enyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 70065777) has the molecular formula C20H25IN2O and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-iodo-N-(3-methylbut-2-enyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-iodo-N-(3-methylbut-2-enyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 70065777 |
| Molecular Formula | C20H25IN2O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-iodo-N-(3-methylbut-2-enyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | CC(C)=CCNC(I)(CN)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25IN2O/c1-16(2)12-13-23-20(21,15-22)18-8-10-19(11-9-18)24-14-17-6-4-3-5-7-17/h3-12,23H,13-15,22H2,1-2H3 |
| InChIKey | LWWFYLMMTBIRCA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|