C20H26ClNO2 — CID 70065805
1-methyl-2-[(4-phenylmethoxyphenoxy)methyl]piperidine;hydrochloride (PubChem CID 70065805) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 1-methyl-2-[(4-phenylmethoxyphenoxy)methyl]piperidine;hydrochloride.
| Compound Name | 1-methyl-2-[(4-phenylmethoxyphenoxy)methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 70065805 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-methyl-2-[(4-phenylmethoxyphenoxy)methyl]piperidine;hydrochloride |
| SMILES | CN1CCCCC1COc1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO2.ClH/c1-21-14-6-5-9-18(21)16-23-20-12-10-19(11-13-20)22-15-17-7-3-2-4-8-17;/h2-4,7-8,10-13,18H,5-6,9,14-16H2,1H3;1H |
| InChIKey | CPWXYGISCQSEFV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |