C31H31N5O4 — CID 70065828
3-[1-benzhydryl-7-[5-(diaminomethylideneamino)pent-1-ynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 70065828) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is 3-[1-benzhydryl-7-[5-(diaminomethylideneamino)pent-1-ynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[1-benzhydryl-7-[5-(diaminomethylideneamino)pent-1-ynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 70065828 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 3-[1-benzhydryl-7-[5-(diaminomethylideneamino)pent-1-ynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NC(N)=NCCCC#Cc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31N5O4/c32-31(33)34-18-9-3-4-10-22-15-16-26-25(20-22)30(40)35(19-17-28(38)39)21-27(37)36(26)29(23-11-5-1-6-12-23)24-13-7-2-8-14-24/h1-2,5-8,11-16,20,29H,3,9,17-19,21H2,(H,38,39)(H4,32,33,34) |
| InChIKey | WHAQMCIZPZRMPU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|