C23H39NO6 — CID 70066228
(2R,3R,5R)-2-[(4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-5-methyloxolane-3-carboxylic acid (PubChem CID 70066228) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is (2R,3R,5R)-2-[(4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-5-methyloxolane-3-carboxylic acid.
| Compound Name | (2R,3R,5R)-2-[(4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-5-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 70066228 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (2R,3R,5R)-2-[(4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-5-methyloxolane-3-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H](C(=O)O)[C@H]([C@@H]2OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]2CC2CCCCC2)O1 |
| InChI | InChI=1S/C23H39NO6/c1-14-12-16(20(25)26)18(28-14)19-17(13-15-10-8-7-9-11-15)24(23(5,6)29-19)21(27)30-22(2,3)4/h14-19H,7-13H2,1-6H3,(H,25,26)/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | WSPLPZPGMIKLCY-IQZDNPOKSA-N |
| XLogP | 4.58 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |