About [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide
[3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide (PubChem CID 70066415) has the molecular formula C25H26N4O5
and a molecular weight of 462.51 g/mol. Its IUPAC name is [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide |
| PubChem CID | 70066415 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide |
| SMILES | Cn1cc(C(=O)CCc2ccc(C#N)cc2)c2cc(OC(=O)O)ccc21.NC(=O)N1CCCC1 |
| InChI | InChI=1S/C20H16N2O4.C5H10N2O/c1-22-12-17(16-10-15(26-20(24)25)7-8-18(16)22)19(23)9-6-13-2-4-14(11-21)5-3-13;6-5(8)7-3-1-2-4-7/h2-5,7-8,10,12H,6,9H2,1H3,(H,24,25);1-4H2,(H2,6,8) |
| InChIKey | QWSQFQSQVCWIBV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide?
The IUPAC name of [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide (CID 70066415) is [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide.
What is the SMILES notation for [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide?
The canonical SMILES for [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide is Cn1cc(C(=O)CCc2ccc(C#N)cc2)c2cc(OC(=O)O)ccc21.NC(=O)N1CCCC1.
What is the InChIKey of [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide?
The InChIKey is QWSQFQSQVCWIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O4.C5H10N2O/c1-22-12-17(16-10-15(26-20(24)25)7-8-18(16)22)19(23)9-6-13-2-4-14(11-21)5-3-13;6-5(8)7-3-1-2-4-7/h2-5,7-8,10,12H,6,9H2,1H3,(H,24,25);1-4H2,(H2,6,8).
What are the key properties of [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide?
[3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide has a molecular weight of 462.51 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(4-cyanophenyl)propanoyl]-1-methylindol-5-yl] hydrogen carbonate;pyrrolidine-1-carboxamide is sourced from PubChem (CID 70066415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).