About 5-bromo-2-iodopyrimidine
5-bromo-2-iodopyrimidine (PubChem CID 7006651) has the molecular formula C4H2BrIN2
and a molecular weight of 284.88 g/mol. Its IUPAC name is 5-bromo-2-iodopyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2-iodopyrimidine |
| PubChem CID | 7006651 |
| Molecular Formula | C4H2BrIN2 |
| Molecular Weight | 284.88 g/mol |
| Exact Mass | 283.84 |
| IUPAC Name | 5-bromo-2-iodopyrimidine |
| SMILES | Brc1cnc(I)nc1 |
| InChI | InChI=1S/C4H2BrIN2/c5-3-1-7-4(6)8-2-3/h1-2H |
| InChIKey | ZEZKXPQIDURFKA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.88 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-iodopyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-iodopyrimidine?
The IUPAC name of 5-bromo-2-iodopyrimidine (CID 7006651) is 5-bromo-2-iodopyrimidine.
What is the SMILES notation for 5-bromo-2-iodopyrimidine?
The canonical SMILES for 5-bromo-2-iodopyrimidine is Brc1cnc(I)nc1.
What is the InChIKey of 5-bromo-2-iodopyrimidine?
The InChIKey is ZEZKXPQIDURFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrIN2/c5-3-1-7-4(6)8-2-3/h1-2H.
What are the key properties of 5-bromo-2-iodopyrimidine?
5-bromo-2-iodopyrimidine has a molecular weight of 284.88 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-iodopyrimidine is sourced from PubChem (CID 7006651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).