About 3-(diethoxymethyl)furan
3-(diethoxymethyl)furan (PubChem CID 7006657) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-(diethoxymethyl)furan.
Molecular Properties
| Compound Name | 3-(diethoxymethyl)furan |
| PubChem CID | 7006657 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-(diethoxymethyl)furan |
| SMILES | CCOC(OCC)c1ccoc1 |
| InChI | InChI=1S/C9H14O3/c1-3-11-9(12-4-2)8-5-6-10-7-8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | MTZMXGCDOYBCPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethoxymethyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethoxymethyl)furan?
The IUPAC name of 3-(diethoxymethyl)furan (CID 7006657) is 3-(diethoxymethyl)furan.
What is the SMILES notation for 3-(diethoxymethyl)furan?
The canonical SMILES for 3-(diethoxymethyl)furan is CCOC(OCC)c1ccoc1.
What is the InChIKey of 3-(diethoxymethyl)furan?
The InChIKey is MTZMXGCDOYBCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-11-9(12-4-2)8-5-6-10-7-8/h5-7,9H,3-4H2,1-2H3.
What are the key properties of 3-(diethoxymethyl)furan?
3-(diethoxymethyl)furan has a molecular weight of 170.21 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethoxymethyl)furan is sourced from PubChem (CID 7006657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).