C13H23N — CID 70067202
N-propyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine (PubChem CID 70067202) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N-propyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine.
| Compound Name | N-propyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 70067202 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-propyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine |
| SMILES | CCCNC1CCCC2CCCC=C21 |
| InChI | InChI=1S/C13H23N/c1-2-10-14-13-9-5-7-11-6-3-4-8-12(11)13/h8,11,13-14H,2-7,9-10H2,1H3 |
| InChIKey | KHWMMBJXVHWOKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|