About 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid
6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 70067342) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 70067342 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCSC1(C)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C10H14O2S/c1-3-13-10(2)7-5-4-6-8(10)9(11)12/h4-8H,3H2,1-2H3,(H,11,12) |
| InChIKey | SZESNQAWQGGDMJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid (CID 70067342) is 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid is CCSC1(C)C=CC=CC1C(=O)O.
What is the InChIKey of 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SZESNQAWQGGDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c1-3-13-10(2)7-5-4-6-8(10)9(11)12/h4-8H,3H2,1-2H3,(H,11,12).
What are the key properties of 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 198.29 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfanyl-6-methylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 70067342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).