C30H33N3O5 — CID 70067686
3-[7-(5-aminopentoxy)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 70067686) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is 3-[7-(5-aminopentoxy)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(5-aminopentoxy)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 70067686 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 3-[7-(5-aminopentoxy)-1-benzhydryl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NCCCCCOc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33N3O5/c31-17-8-3-9-19-38-24-14-15-26-25(20-24)30(37)32(18-16-28(35)36)21-27(34)33(26)29(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-2,4-7,10-15,20,29H,3,8-9,16-19,21,31H2,(H,35,36) |
| InChIKey | YHWISSDSEJBWGW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|