About 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid
2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid (PubChem CID 70067724) has the molecular formula C14H16ClN5O4S
and a molecular weight of 385.83 g/mol. Its IUPAC name is 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid |
| PubChem CID | 70067724 |
| Molecular Formula | C14H16ClN5O4S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NS(=O)(=O)c1ccc2c(NC(N)=NCl)cncc2c1)C(=O)O |
| InChI | InChI=1S/C14H16ClN5O4S/c1-14(2,12(21)22)20-25(23,24)9-3-4-10-8(5-9)6-17-7-11(10)18-13(16)19-15/h3-7,20H,1-2H3,(H,21,22)(H3,16,18,19) |
| InChIKey | BVCUURHLRAIYMU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid?
The IUPAC name of 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid (CID 70067724) is 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid?
The canonical SMILES for 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid is CC(C)(NS(=O)(=O)c1ccc2c(NC(N)=NCl)cncc2c1)C(=O)O.
What is the InChIKey of 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid?
The InChIKey is BVCUURHLRAIYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN5O4S/c1-14(2,12(21)22)20-25(23,24)9-3-4-10-8(5-9)6-17-7-11(10)18-13(16)19-15/h3-7,20H,1-2H3,(H,21,22)(H3,16,18,19).
What are the key properties of 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid?
2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid has a molecular weight of 385.83 g/mol, XLogP of 1.26, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid is sourced from PubChem (CID 70067724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).