C15H19N3O3S — CID 70067759
N-methyl-2-oxo-8-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)octanamide (PubChem CID 70067759) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-methyl-2-oxo-8-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)octanamide.
| Compound Name | N-methyl-2-oxo-8-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)octanamide |
|---|---|
| PubChem CID | 70067759 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-methyl-2-oxo-8-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)octanamide |
| SMILES | CNC(=O)C(=O)CCCCCCc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C15H19N3O3S/c1-16-14(20)11(19)7-4-2-3-5-9-13-17-18-15(21-13)12-8-6-10-22-12/h6,8,10H,2-5,7,9H2,1H3,(H,16,20) |
| InChIKey | SXGXPHXYTOWGAX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|