About 5-methyl-4,5-dihydro-1,3-thiazol-4-ol
5-methyl-4,5-dihydro-1,3-thiazol-4-ol (PubChem CID 70067896) has the molecular formula C4H7NOS
and a molecular weight of 117.17 g/mol. Its IUPAC name is 5-methyl-4,5-dihydro-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 5-methyl-4,5-dihydro-1,3-thiazol-4-ol |
| PubChem CID | 70067896 |
| Molecular Formula | C4H7NOS |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | 5-methyl-4,5-dihydro-1,3-thiazol-4-ol |
| SMILES | CC1SC=NC1O |
| InChI | InChI=1S/C4H7NOS/c1-3-4(6)5-2-7-3/h2-4,6H,1H3 |
| InChIKey | XHQJDRCVNPTUCC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4,5-dihydro-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,5-dihydro-1,3-thiazol-4-ol?
The IUPAC name of 5-methyl-4,5-dihydro-1,3-thiazol-4-ol (CID 70067896) is 5-methyl-4,5-dihydro-1,3-thiazol-4-ol.
What is the SMILES notation for 5-methyl-4,5-dihydro-1,3-thiazol-4-ol?
The canonical SMILES for 5-methyl-4,5-dihydro-1,3-thiazol-4-ol is CC1SC=NC1O.
What is the InChIKey of 5-methyl-4,5-dihydro-1,3-thiazol-4-ol?
The InChIKey is XHQJDRCVNPTUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS/c1-3-4(6)5-2-7-3/h2-4,6H,1H3.
What are the key properties of 5-methyl-4,5-dihydro-1,3-thiazol-4-ol?
5-methyl-4,5-dihydro-1,3-thiazol-4-ol has a molecular weight of 117.17 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,5-dihydro-1,3-thiazol-4-ol is sourced from PubChem (CID 70067896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).